Bekanamycin |
|
| AHFS/Drugs.com | International Drug Names |
|---|
| ATC code | |
|---|
|
| Legal status |
- In general: ℞ (Prescription only)
|
|---|
|
(2S,3R,4S,5S,6R)-4-amino-2-{[(2S,3R,4S,6R)-4,6-diamino-3-{[(2R,3R,4R,5S,6R)-3-amino-6-(aminomethyl)-4,5-dihydroxyoxan-2-yl]oxy}-2-hydroxycyclohexyl]oxy}-6-(hydroxymethyl)oxane-3,5-diol
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| ChEBI | |
|---|
| ChEMBL | |
|---|
| NIAID ChemDB | |
|---|
| CompTox Dashboard (EPA) | |
|---|
| ECHA InfoCard | 100.022.881 |
|---|
|
| Formula | C18H37N5O10 |
|---|
| Molar mass | 483.519 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
C1[C@@H]([C@H]([C@@H]([C@H]([C@@H]1N)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)N)O)O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CN)O)O)N)N
|
InChI=1S/C18H37N5O10/c19-2-6-11(26)12(27)9(23)17(30-6)32-15-4(20)1-5(21)16(14(15)29)33-18-13(28)8(22)10(25)7(3-24)31-18/h4-18,24-29H,1-3,19-23H2/t4-,5+,6+,7+,8-,9+,10+,11+,12+,13+,14-,15+,16-,17+,18+/m0/s1 YKey:SKKLOUVUUNMCJE-FQSMHNGLSA-N Y
|
N Y (what is this?) (verify) |
Bekanamycin (INN; kanamycin B) is an aminoglycoside antibiotic.[1][2]
References
- ^ Morales MA, Castrillon JL, Hernandez DA (1993). "Effects of bekanamycin and dibekacin on the electrical activity of cardiac pacemaker cells". Archives of Medical Research. 24 (4): 339–45. PMID 8118157.
- ^ PubChem. "Bekanamycin". pubchem.ncbi.nlm.nih.gov. Retrieved 2023-07-04.
Antibacterials that inhibit protein synthesis (J01A, J01B, J01F, J01G, QJ01XQ) |
|---|
| 30S | Aminoglycosides (initiation inhibitors) | | -mycin (Streptomyces) | |
|---|
| -micin (Micromonospora) | |
|---|
| other | |
|---|
|
|---|
Tetracycline antibiotics (tRNA binding) | | Tetracyclines | |
|---|
| Glycylcyclines | |
|---|
|
|---|
|
|---|
| 50S | Oxazolidinone (initiation inhibitors) |
- Eperezolid
- Linezolid#
- Posizolid
- Radezolid
- Ranbezolid
- Sutezolid
- Tedizolid
|
|---|
| Peptidyl transferase | |
|---|
| MLS (transpeptidation/translocation) | | Macrolides | |
|---|
| Azalides | |
|---|
| Ketolides | |
|---|
| Lincosamides | |
|---|
| Oxepanoprolinamides | |
|---|
| Streptogramins |
- Pristinamycin (IA, IIA, IIB)
- NXL103 (Flopristin, Linopristin)
- Quinupristin/dalfopristin (Dalfopristin, Quinupristin)
- Streptogramin A
- Streptogramin B
- Virginiamycin (S1)
|
|---|
|
|---|
|
|---|
- #WHO-EM
- ‡Withdrawn from market
- Clinical trials:
- †Phase III
- §Never to phase III
|