Edoxudine |
|
| ATC code | |
|---|
|
| Legal status |
- In general: ℞ (Prescription only)
|
|---|
|
5-ethyl-1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| DrugBank | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| ChEMBL | |
|---|
| CompTox Dashboard (EPA) | |
|---|
| ECHA InfoCard | 100.035.645 |
|---|
|
| Formula | C11H16N2O5 |
|---|
| Molar mass | 256.258 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
O=C/1NC(=O)N(\C=C\1CC)[C@@H]2O[C@@H]([C@@H](O)C2)CO
|
InChI=1S/C11H16N2O5/c1-2-6-4-13(11(17)12-10(6)16)9-3-7(15)8(5-14)18-9/h4,7-9,14-15H,2-3,5H2,1H3,(H,12,16,17)/t7-,8+,9+/m0/s1 NKey:XACKNLSZYYIACO-DJLDLDEBSA-N N
|
N Y (what is this?) (verify) |
Edoxudine (or edoxudin) is an antiviral drug. It is an analog of thymidine, a nucleoside.
It has shown effectiveness against herpes simplex virus.[1]
References
Antibiotics and chemotherapeutics for dermatological use (D06) |
|---|
| Antibiotics | | Tetracycline and derivatives | |
|---|
| Others |
- Streptogramin: Virginiamycin
|
|---|
|
|---|
| Chemotherapeutics | | Sulfonamides | |
|---|
| Antivirals | |
|---|
| Other | |
|---|
|
|---|
DNA virus antivirals (primarily J05, also S01AD and D06BB) |
|---|
| Baltimore I | | Herpesvirus | DNA-synthesis inhibitor | | TK activated | | Purine analogue | |
|---|
| Pyrimidine analogue |
- thymine
- Brivudine
- FV-100†
- Sorivudine‡
|
|---|
|
|---|
| Not TK activated | |
|---|
|
|---|
| Other |
- Amenamevir
- Docosanol
- Letermovir
- Maribavir
- early protein (Fomivirsen‡)
- Tromantadine
|
|---|
|
|---|
| HPV/MC | |
|---|
| Vaccinia | |
|---|
| Poxviridae | |
|---|
|
|---|
| Hepatitis B (VII) | |
|---|
| Multiple/general | | Nucleic acid inhibitors | |
|---|
| Interferon |
- Interferon alfa 2b
- Peginterferon alfa-2a#
|
|---|
| Multiple/unknown |
- Filociclovir†
- Ribavirin#/Taribavirin†
- Moroxydine
|
|---|
|
|---|
- #WHO-EM
- ‡Withdrawn from market
- Clinical trials:
- †Phase III
- §Never to phase III
|