Sulfaphenazole |
 |
|
| AHFS/Drugs.com | International Drug Names |
|---|
| ATC code | |
|---|
|
4-amino-N-(1-phenyl-1H-pyrazol-5-yl)benzenesulfonamide
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| DrugBank | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| KEGG | |
|---|
| ChEMBL | |
|---|
| CompTox Dashboard (EPA) | |
|---|
| ECHA InfoCard | 100.007.624 |
|---|
|
| Formula | C15H14N4O2S |
|---|
| Molar mass | 314.36 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
O=S(=O)(c1ccc(N)cc1)Nc3ccnn3c2ccccc2
|
InChI=1S/C15H14N4O2S/c16-12-6-8-14(9-7-12)22(20,21)18-15-10-11-17-19(15)13-4-2-1-3-5-13/h1-11,18H,16H2 YKey:QWCJHSGMANYXCW-UHFFFAOYSA-N Y
|
N Y (what is this?) (verify) |
Sulfaphenazole (or sulfafenazol) is a sulfonamide antibacterial.[1]
References
- ^ Browne SG (1961). "Trial of a long-acting sulfonamide sulfaphenazole (Orisul, Ciba), in the treatment of leprosy". International Journal of Leprosy. 29: 502–5. PMID 13873771.
Antibacterials that inhibit nucleic acid (J01E, J01M) |
|---|
Antifolates (inhibit bacterial purine metabolism, thereby inhibiting DNA and RNA synthesis) | | DHFR inhibitor | |
|---|
Sulfonamides (DHPS inhibitor) | | Short-acting | |
|---|
| Intermediate-acting | |
|---|
| Long-acting | |
|---|
| Other/ungrouped | |
|---|
|
|---|
| Combinations | |
|---|
| Other DHPS inhibitors | |
|---|
|
|---|
Quinolones (inhibit bacterial topoisomerase and/or DNA gyrase, thereby inhibiting DNA replication) | | 1st generation | |
|---|
| Fluoroquinolones | | 2nd generation | |
|---|
| 3rd generation | |
|---|
| 4th generation | |
|---|
| Veterinary | |
|---|
|
|---|
| Newer non-fluorinated | |
|---|
| Related (DG) | |
|---|
|
|---|
Anaerobic DNA inhibitors | | Nitroimidazole derivatives | |
|---|
|
|---|
| RNA synthesis | Rifamycins/ RNA polymerase | |
|---|
| Lipiarmycins | |
|---|
|
|---|
- #WHO-EM
- ‡Withdrawn from market
- Clinical trials:
- †Phase III
- §Never to phase III
|
Ophthalmologicals: anti-infectives (S01A) |
|---|
| Antibiotics | |
|---|
| Sulfonamides | |
|---|
| Antivirals | |
|---|
| Fluoroquinolones | |
|---|
| Other | |
|---|